C29H29ClN6O2 — CID 10951551
2-[2-benzyl-3-chloro-6-oxo-5-(2-phenylethylamino)pyrazin-1-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide (PubChem CID 10951551) has the molecular formula C29H29ClN6O2 and a molecular weight of 529.04 g/mol. Its IUPAC name is 2-[2-benzyl-3-chloro-6-oxo-5-(2-phenylethylamino)pyrazin-1-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide.
| Compound Name | 2-[2-benzyl-3-chloro-6-oxo-5-(2-phenylethylamino)pyrazin-1-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 10951551 |
| Molecular Formula | C29H29ClN6O2 |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 2-[2-benzyl-3-chloro-6-oxo-5-(2-phenylethylamino)pyrazin-1-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(Cc3ccccc3)c(Cl)nc(NCCc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C29H29ClN6O2/c30-26-24(17-21-9-5-2-6-10-21)36(19-25(37)34-18-22-11-13-23(14-12-22)27(31)32)29(38)28(35-26)33-16-15-20-7-3-1-4-8-20/h1-14H,15-19H2,(H3,31,32)(H,33,35)(H,34,37) |
| InChIKey | GHRLUTXGFDQPAX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|