C24H29N9O5 — CID 10208350
3-amino-5-[4-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-6-(2,2-diethylhydrazinyl)-3,5-dioxo-1,2,4-triazin-2-yl]benzoic acid (PubChem CID 10208350) has the molecular formula C24H29N9O5 and a molecular weight of 523.55 g/mol. Its IUPAC name is 3-amino-5-[4-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-6-(2,2-diethylhydrazinyl)-3,5-dioxo-1,2,4-triazin-2-yl]benzoic acid.
| Compound Name | 3-amino-5-[4-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-6-(2,2-diethylhydrazinyl)-3,5-dioxo-1,2,4-triazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 10208350 |
| Molecular Formula | C24H29N9O5 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 3-amino-5-[4-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-6-(2,2-diethylhydrazinyl)-3,5-dioxo-1,2,4-triazin-2-yl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(=O)c(NN(CC)CC)nn(-c3cc(N)cc(C(=O)O)c3)c2=O)cc1 |
| InChI | InChI=1S/C24H29N9O5/c1-3-31(4-2)29-21-22(35)32(13-19(34)28-12-14-5-7-15(8-6-14)20(26)27)24(38)33(30-21)18-10-16(23(36)37)9-17(25)11-18/h5-11H,3-4,12-13,25H2,1-2H3,(H3,26,27)(H,28,34)(H,29,30)(H,36,37) |
| InChIKey | ZTTRLKVQZVRVGX-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 214.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|