C24H27N7O4 — CID 70098762
3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-5-[methyl(methylamino)amino]-6-oxo-2-pyridinyl]benzoic acid (PubChem CID 70098762) has the molecular formula C24H27N7O4 and a molecular weight of 477.53 g/mol. Its IUPAC name is 3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-5-[methyl(methylamino)amino]-6-oxo-2-pyridinyl]benzoic acid.
| Compound Name | 3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-5-[methyl(methylamino)amino]-6-oxo-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 70098762 |
| Molecular Formula | C24H27N7O4 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-5-[methyl(methylamino)amino]-6-oxo-2-pyridinyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3cc(N)cc(C(=O)O)c3)ccc(N(C)NC)c2=O)cc1 |
| InChI | InChI=1S/C24H27N7O4/c1-28-30(2)20-8-7-19(16-9-17(24(34)35)11-18(25)10-16)31(23(20)33)13-21(32)29-12-14-3-5-15(6-4-14)22(26)27/h3-11,28H,12-13,25H2,1-2H3,(H3,26,27)(H,29,32)(H,34,35) |
| InChIKey | HBQRRERZIXAWFD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 179.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|