C26H31N7O2 — CID 142097195
N-[(4-carbamimidoylphenyl)methyl]-3-[3-(cyclobutylamino)-6-(3,5-diaminophenyl)-2-oxo-1-pyridinyl]propanamide (PubChem CID 142097195) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-3-[3-(cyclobutylamino)-6-(3,5-diaminophenyl)-2-oxo-1-pyridinyl]propanamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-3-[3-(cyclobutylamino)-6-(3,5-diaminophenyl)-2-oxo-1-pyridinyl]propanamide |
|---|---|
| PubChem CID | 142097195 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-3-[3-(cyclobutylamino)-6-(3,5-diaminophenyl)-2-oxo-1-pyridinyl]propanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CCn2c(-c3cc(N)cc(N)c3)ccc(NC3CCC3)c2=O)cc1 |
| InChI | InChI=1S/C26H31N7O2/c27-19-12-18(13-20(28)14-19)23-9-8-22(32-21-2-1-3-21)26(35)33(23)11-10-24(34)31-15-16-4-6-17(7-5-16)25(29)30/h4-9,12-14,21,32H,1-3,10-11,15,27-28H2,(H3,29,30)(H,31,34) |
| InChIKey | XJVJVDCPGJXTPM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 165.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|