C36H44N4O4 — CID 159773774
benzyl N-[amino-[4-[[[(2R,5R)-5-(cyclohexylamino)-2-methyl-4-oxo-7-phenylheptanoyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 159773774) has the molecular formula C36H44N4O4 and a molecular weight of 596.77 g/mol. Its IUPAC name is benzyl N-[amino-[4-[[[(2R,5R)-5-(cyclohexylamino)-2-methyl-4-oxo-7-phenylheptanoyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[4-[[[(2R,5R)-5-(cyclohexylamino)-2-methyl-4-oxo-7-phenylheptanoyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 159773774 |
| Molecular Formula | C36H44N4O4 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.34 |
| IUPAC Name | benzyl N-[amino-[4-[[[(2R,5R)-5-(cyclohexylamino)-2-methyl-4-oxo-7-phenylheptanoyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | C[C@H](CC(=O)[C@@H](CCc1ccccc1)NC1CCCCC1)C(=O)NCc1ccc(C(N)=NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H44N4O4/c1-26(23-33(41)32(39-31-15-9-4-10-16-31)22-19-27-11-5-2-6-12-27)35(42)38-24-28-17-20-30(21-18-28)34(37)40-36(43)44-25-29-13-7-3-8-14-29/h2-3,5-8,11-14,17-18,20-21,26,31-32,39H,4,9-10,15-16,19,22-25H2,1H3,(H,38,42)(H2,37,40,43)/t26-,32-/m1/s1 |
| InChIKey | XYVMWUZCMLBOHJ-HVIPQOSHSA-N |
| XLogP | 5.86 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|