C36H37N5O7 — CID 175136274
benzyl N-[amino-[4-[[[2-[(2-carbamoyloxy-4-phenylbutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 175136274) has the molecular formula C36H37N5O7 and a molecular weight of 651.72 g/mol. Its IUPAC name is benzyl N-[amino-[4-[[[2-[(2-carbamoyloxy-4-phenylbutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[4-[[[2-[(2-carbamoyloxy-4-phenylbutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 175136274 |
| Molecular Formula | C36H37N5O7 |
| Molecular Weight | 651.72 g/mol |
| Exact Mass | 651.27 |
| IUPAC Name | benzyl N-[amino-[4-[[[2-[(2-carbamoyloxy-4-phenylbutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | NC(=O)OC(CCc1ccccc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)NCc1ccc(C(N)=NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H37N5O7/c37-32(41-36(46)47-23-27-9-5-2-6-10-27)28-16-11-26(12-17-28)22-39-33(43)30(21-25-13-18-29(42)19-14-25)40-34(44)31(48-35(38)45)20-15-24-7-3-1-4-8-24/h1-14,16-19,30-31,42H,15,20-23H2,(H2,38,45)(H,39,43)(H,40,44)(H2,37,41,46) |
| InChIKey | QLFBAJWBWDAEFL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 195.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.72 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|