C26H37N3O2 — CID 175552079
N-benzylpropanamide;(2R)-2-(cyclohexylamino)-4-phenylbutanamide (PubChem CID 175552079) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is N-benzylpropanamide;(2R)-2-(cyclohexylamino)-4-phenylbutanamide.
| Compound Name | N-benzylpropanamide;(2R)-2-(cyclohexylamino)-4-phenylbutanamide |
|---|---|
| PubChem CID | 175552079 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | N-benzylpropanamide;(2R)-2-(cyclohexylamino)-4-phenylbutanamide |
| SMILES | CCC(=O)NCc1ccccc1.NC(=O)[C@@H](CCc1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C16H24N2O.C10H13NO/c17-16(19)15(18-14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;1-2-10(12)11-8-9-6-4-3-5-7-9/h1,3-4,7-8,14-15,18H,2,5-6,9-12H2,(H2,17,19);3-7H,2,8H2,1H3,(H,11,12)/t15-;/m1./s1 |
| InChIKey | WZQXHXPGYWGGCH-XFULWGLBSA-N |
| XLogP | 4.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |