C31H35N5O4 — CID 159529924
benzyl N-[amino-[4-[[[(2S)-2-[[(2R,4R)-4-(3-methylphenyl)pyrrolidine-2-carbonyl]amino]propanoyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 159529924) has the molecular formula C31H35N5O4 and a molecular weight of 541.65 g/mol. Its IUPAC name is benzyl N-[amino-[4-[[[(2S)-2-[[(2R,4R)-4-(3-methylphenyl)pyrrolidine-2-carbonyl]amino]propanoyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[4-[[[(2S)-2-[[(2R,4R)-4-(3-methylphenyl)pyrrolidine-2-carbonyl]amino]propanoyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 159529924 |
| Molecular Formula | C31H35N5O4 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | benzyl N-[amino-[4-[[[(2S)-2-[[(2R,4R)-4-(3-methylphenyl)pyrrolidine-2-carbonyl]amino]propanoyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | Cc1cccc([C@@H]2CN[C@@H](C(=O)N[C@@H](C)C(=O)NCc3ccc(C(N)=NC(=O)OCc4ccccc4)cc3)C2)c1 |
| InChI | InChI=1S/C31H35N5O4/c1-20-7-6-10-25(15-20)26-16-27(33-18-26)30(38)35-21(2)29(37)34-17-22-11-13-24(14-12-22)28(32)36-31(39)40-19-23-8-4-3-5-9-23/h3-15,21,26-27,33H,16-19H2,1-2H3,(H,34,37)(H,35,38)(H2,32,36,39)/t21-,26-,27+/m0/s1 |
| InChIKey | SKHFZTMXGCUDCM-NJTBCWBZSA-N |
| XLogP | 3.30 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|