C26H27F6N5O7 — CID 175888221
(2R,4R)-N-[(2S)-1-[(3-amino-1,2-benzoxazol-6-yl)methylamino]-1-oxopropan-2-yl]-4-phenylpyrrolidine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 175888221) has the molecular formula C26H27F6N5O7 and a molecular weight of 635.52 g/mol. Its IUPAC name is (2R,4R)-N-[(2S)-1-[(3-amino-1,2-benzoxazol-6-yl)methylamino]-1-oxopropan-2-yl]-4-phenylpyrrolidine-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2R,4R)-N-[(2S)-1-[(3-amino-1,2-benzoxazol-6-yl)methylamino]-1-oxopropan-2-yl]-4-phenylpyrrolidine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 175888221 |
| Molecular Formula | C26H27F6N5O7 |
| Molecular Weight | 635.52 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | (2R,4R)-N-[(2S)-1-[(3-amino-1,2-benzoxazol-6-yl)methylamino]-1-oxopropan-2-yl]-4-phenylpyrrolidine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C[C@H](NC(=O)[C@H]1C[C@H](c2ccccc2)CN1)C(=O)NCc1ccc2c(N)noc2c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H25N5O3.2C2HF3O2/c1-13(21(28)25-11-14-7-8-17-19(9-14)30-27-20(17)23)26-22(29)18-10-16(12-24-18)15-5-3-2-4-6-15;2*3-2(4,5)1(6)7/h2-9,13,16,18,24H,10-12H2,1H3,(H2,23,27)(H,25,28)(H,26,29);2*(H,6,7)/t13-,16-,18+;;/m0../s1 |
| InChIKey | SUAKDIUMNVQTRW-MYGZGKEZSA-N |
| XLogP | 2.94 |
| TPSA | 196.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |