C25H28Cl3N5O4 — CID 172867851
2,2,2-trichloroethyl N-[amino-[4-[[[(2S)-2-[[(2R,4R)-4-phenylpyrrolidine-2-carbonyl]amino]propanoyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 172867851) has the molecular formula C25H28Cl3N5O4 and a molecular weight of 568.89 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[amino-[4-[[[(2S)-2-[[(2R,4R)-4-phenylpyrrolidine-2-carbonyl]amino]propanoyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[amino-[4-[[[(2S)-2-[[(2R,4R)-4-phenylpyrrolidine-2-carbonyl]amino]propanoyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 172867851 |
| Molecular Formula | C25H28Cl3N5O4 |
| Molecular Weight | 568.89 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 2,2,2-trichloroethyl N-[amino-[4-[[[(2S)-2-[[(2R,4R)-4-phenylpyrrolidine-2-carbonyl]amino]propanoyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | C[C@H](NC(=O)[C@H]1C[C@H](c2ccccc2)CN1)C(=O)NCc1ccc(C(N)=NC(=O)OCC(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C25H28Cl3N5O4/c1-15(32-23(35)20-11-19(13-30-20)17-5-3-2-4-6-17)22(34)31-12-16-7-9-18(10-8-16)21(29)33-24(36)37-14-25(26,27)28/h2-10,15,19-20,30H,11-14H2,1H3,(H,31,34)(H,32,35)(H2,29,33,36)/t15-,19-,20+/m0/s1 |
| InChIKey | RHJHNESFAJXCST-RYGJVYDSSA-N |
| XLogP | 3.17 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.89 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|