C35H41N5O6 — CID 174042084
tert-butyl (2R,4S)-2-[[(2S)-1-[[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylamino]-1-oxopropan-2-yl]carbamoyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 174042084) has the molecular formula C35H41N5O6 and a molecular weight of 627.74 g/mol. Its IUPAC name is tert-butyl (2R,4S)-2-[[(2S)-1-[[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylamino]-1-oxopropan-2-yl]carbamoyl]-4-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-2-[[(2S)-1-[[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylamino]-1-oxopropan-2-yl]carbamoyl]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 174042084 |
| Molecular Formula | C35H41N5O6 |
| Molecular Weight | 627.74 g/mol |
| Exact Mass | 627.31 |
| IUPAC Name | tert-butyl (2R,4S)-2-[[(2S)-1-[[4-(N'-benzoyloxycarbamimidoyl)phenyl]methylamino]-1-oxopropan-2-yl]carbamoyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | C[C@H](NC(=O)[C@H]1C[C@@H](c2ccccc2)CCN1C(=O)OC(C)(C)C)C(=O)NCc1ccc(C(N)=NOC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H41N5O6/c1-23(31(41)37-22-24-15-17-26(18-16-24)30(36)39-46-33(43)27-13-9-6-10-14-27)38-32(42)29-21-28(25-11-7-5-8-12-25)19-20-40(29)34(44)45-35(2,3)4/h5-18,23,28-29H,19-22H2,1-4H3,(H2,36,39)(H,37,41)(H,38,42)/t23-,28-,29+/m0/s1 |
| InChIKey | NKJGJQZBYSYZPO-WTWMYVDVSA-N |
| XLogP | 4.47 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|