C27H36N4O5S — CID 172916982
tert-butyl (2R,4S)-2-[[(2S)-5-[5-[(Z)-N'-hydroxycarbamimidoyl]thiophen-2-yl]-3-oxopentan-2-yl]carbamoyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 172916982) has the molecular formula C27H36N4O5S and a molecular weight of 528.68 g/mol. Its IUPAC name is tert-butyl (2R,4S)-2-[[(2S)-5-[5-[(Z)-N'-hydroxycarbamimidoyl]thiophen-2-yl]-3-oxopentan-2-yl]carbamoyl]-4-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-2-[[(2S)-5-[5-[(Z)-N'-hydroxycarbamimidoyl]thiophen-2-yl]-3-oxopentan-2-yl]carbamoyl]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 172916982 |
| Molecular Formula | C27H36N4O5S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | tert-butyl (2R,4S)-2-[[(2S)-5-[5-[(Z)-N'-hydroxycarbamimidoyl]thiophen-2-yl]-3-oxopentan-2-yl]carbamoyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | C[C@H](NC(=O)[C@H]1C[C@@H](c2ccccc2)CCN1C(=O)OC(C)(C)C)C(=O)CCc1ccc(/C(N)=N/O)s1 |
| InChI | InChI=1S/C27H36N4O5S/c1-17(22(32)12-10-20-11-13-23(37-20)24(28)30-35)29-25(33)21-16-19(18-8-6-5-7-9-18)14-15-31(21)26(34)36-27(2,3)4/h5-9,11,13,17,19,21,35H,10,12,14-16H2,1-4H3,(H2,28,30)(H,29,33)/t17-,19-,21+/m0/s1 |
| InChIKey | RTZYWNRYLCASHG-HFSMHLIXSA-N |
| XLogP | 4.03 |
| TPSA | 134.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|