C24H30N4O5S — CID 163226361
tert-butyl (2S,4R)-2-[[4-[(E)-N'-acetyloxycarbamimidoyl]thiophen-2-yl]methylcarbamoyl]-4-phenylpyrrolidine-1-carboxylate (PubChem CID 163226361) has the molecular formula C24H30N4O5S and a molecular weight of 486.59 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[[4-[(E)-N'-acetyloxycarbamimidoyl]thiophen-2-yl]methylcarbamoyl]-4-phenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[[4-[(E)-N'-acetyloxycarbamimidoyl]thiophen-2-yl]methylcarbamoyl]-4-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163226361 |
| Molecular Formula | C24H30N4O5S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | tert-butyl (2S,4R)-2-[[4-[(E)-N'-acetyloxycarbamimidoyl]thiophen-2-yl]methylcarbamoyl]-4-phenylpyrrolidine-1-carboxylate |
| SMILES | CC(=O)O/N=C(/N)c1csc(CNC(=O)[C@@H]2C[C@H](c3ccccc3)CN2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C24H30N4O5S/c1-15(29)33-27-21(25)18-10-19(34-14-18)12-26-22(30)20-11-17(16-8-6-5-7-9-16)13-28(20)23(31)32-24(2,3)4/h5-10,14,17,20H,11-13H2,1-4H3,(H2,25,27)(H,26,30)/t17-,20-/m0/s1 |
| InChIKey | DNRPPMQGHPYAFG-PXNSSMCTSA-N |
| XLogP | 3.34 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|