C33H32FN5O4S — CID 169199035
(2S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]-4-(2-methylphenyl)pyrrolidine-2-carboxamide (PubChem CID 169199035) has the molecular formula C33H32FN5O4S and a molecular weight of 613.72 g/mol. Its IUPAC name is (2S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]-4-(2-methylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]-4-(2-methylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 169199035 |
| Molecular Formula | C33H32FN5O4S |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | (2S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-1-[2-[[4-(4-fluorophenoxy)benzoyl]amino]acetyl]-4-(2-methylphenyl)pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)[C@@H]2C[C@H](c3ccccc3C)CN2C(=O)CNC(=O)c2ccc(Oc3ccc(F)cc3)cc2)c1 |
| InChI | InChI=1S/C33H32FN5O4S/c1-20-4-2-3-5-28(20)22-15-29(33(42)37-16-27-14-23(19-44-27)31(35)36)39(18-22)30(40)17-38-32(41)21-6-10-25(11-7-21)43-26-12-8-24(34)9-13-26/h2-14,19,22,29H,15-18H2,1H3,(H3,35,36)(H,37,42)(H,38,41)/t22-,29-/m0/s1 |
| InChIKey | YIQGYVWCWCMPJA-ZTOMLWHTSA-N |
| XLogP | 4.70 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|