C25H25N5O4S2 — CID 162515494
(4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-3-[2-[(4-phenoxybenzoyl)amino]acetyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 162515494) has the molecular formula C25H25N5O4S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is (4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-3-[2-[(4-phenoxybenzoyl)amino]acetyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-3-[2-[(4-phenoxybenzoyl)amino]acetyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 162515494 |
| Molecular Formula | C25H25N5O4S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | (4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-3-[2-[(4-phenoxybenzoyl)amino]acetyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)[C@@H]2CSCN2C(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H25N5O4S2/c26-23(27)17-10-20(36-13-17)11-28-25(33)21-14-35-15-30(21)22(31)12-29-24(32)16-6-8-19(9-7-16)34-18-4-2-1-3-5-18/h1-10,13,21H,11-12,14-15H2,(H3,26,27)(H,28,33)(H,29,32)/t21-/m0/s1 |
| InChIKey | SOXSSHNKRRPGBI-NRFANRHFSA-N |
| XLogP | 2.77 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|