C33H33N5O5S — CID 159761305
(2S,4S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-(2-methylphenoxy)-1-[2-[(4-phenoxybenzoyl)amino]acetyl]pyrrolidine-2-carboxamide (PubChem CID 159761305) has the molecular formula C33H33N5O5S and a molecular weight of 611.72 g/mol. Its IUPAC name is (2S,4S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-(2-methylphenoxy)-1-[2-[(4-phenoxybenzoyl)amino]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-(2-methylphenoxy)-1-[2-[(4-phenoxybenzoyl)amino]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 159761305 |
| Molecular Formula | C33H33N5O5S |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.22 |
| IUPAC Name | (2S,4S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-(2-methylphenoxy)-1-[2-[(4-phenoxybenzoyl)amino]acetyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)[C@@H]2C[C@H](Oc3ccccc3C)CN2C(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C33H33N5O5S/c1-21-7-5-6-10-29(21)43-26-16-28(33(41)36-17-27-15-23(20-44-27)31(34)35)38(19-26)30(39)18-37-32(40)22-11-13-25(14-12-22)42-24-8-3-2-4-9-24/h2-15,20,26,28H,16-19H2,1H3,(H3,34,35)(H,36,41)(H,37,40)/t26-,28-/m0/s1 |
| InChIKey | NEXOGKGDVBTULD-XCZPVHLTSA-N |
| XLogP | 4.23 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|