C29H33N5O5S — CID 163225712
(2S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-phenoxy-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxamide (PubChem CID 163225712) has the molecular formula C29H33N5O5S and a molecular weight of 563.68 g/mol. Its IUPAC name is (2S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-phenoxy-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-phenoxy-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163225712 |
| Molecular Formula | C29H33N5O5S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | (2S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-phenoxy-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)[C@@H]2C[C@@H](Oc3ccccc3)CN2C(=O)CNC(=O)CCCOc2ccccc2)c1 |
| InChI | InChI=1S/C29H33N5O5S/c30-28(31)20-14-24(40-19-20)16-33-29(37)25-15-23(39-22-10-5-2-6-11-22)18-34(25)27(36)17-32-26(35)12-7-13-38-21-8-3-1-4-9-21/h1-6,8-11,14,19,23,25H,7,12-13,15-18H2,(H3,30,31)(H,32,35)(H,33,37)/t23-,25+/m1/s1 |
| InChIKey | GQVDOMBPSGOMHU-NOZRDPDXSA-N |
| XLogP | 2.67 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|