C25H31F2N5O4S — CID 163226178
N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-(2,2-difluoroethyl)-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxamide (PubChem CID 163226178) has the molecular formula C25H31F2N5O4S and a molecular weight of 535.62 g/mol. Its IUPAC name is N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-(2,2-difluoroethyl)-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-(2,2-difluoroethyl)-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163226178 |
| Molecular Formula | C25H31F2N5O4S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | N-[(4-carbamimidoylthiophen-2-yl)methyl]-4-(2,2-difluoroethyl)-1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)C2CC(CC(F)F)CN2C(=O)CNC(=O)CCCOc2ccccc2)c1 |
| InChI | InChI=1S/C25H31F2N5O4S/c26-21(27)10-16-9-20(25(35)31-12-19-11-17(15-37-19)24(28)29)32(14-16)23(34)13-30-22(33)7-4-8-36-18-5-2-1-3-6-18/h1-3,5-6,11,15-16,20-21H,4,7-10,12-14H2,(H3,28,29)(H,30,33)(H,31,35) |
| InChIKey | HCUHHOGDPYZRQE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|