C26H32N6O6S — CID 170165060
(7S)-7-[(4-carbamimidoylthiophen-2-yl)methylcarbamoyl]-6-[2-(4-phenoxybutanoylamino)acetyl]-2,6-diazaspiro[3.4]octane-2-carboxylic acid (PubChem CID 170165060) has the molecular formula C26H32N6O6S and a molecular weight of 556.65 g/mol. Its IUPAC name is (7S)-7-[(4-carbamimidoylthiophen-2-yl)methylcarbamoyl]-6-[2-(4-phenoxybutanoylamino)acetyl]-2,6-diazaspiro[3.4]octane-2-carboxylic acid.
| Compound Name | (7S)-7-[(4-carbamimidoylthiophen-2-yl)methylcarbamoyl]-6-[2-(4-phenoxybutanoylamino)acetyl]-2,6-diazaspiro[3.4]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 170165060 |
| Molecular Formula | C26H32N6O6S |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | (7S)-7-[(4-carbamimidoylthiophen-2-yl)methylcarbamoyl]-6-[2-(4-phenoxybutanoylamino)acetyl]-2,6-diazaspiro[3.4]octane-2-carboxylic acid |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)[C@@H]2CC3(CN(C(=O)O)C3)CN2C(=O)CNC(=O)CCCOc2ccccc2)c1 |
| InChI | InChI=1S/C26H32N6O6S/c27-23(28)17-9-19(39-13-17)11-30-24(35)20-10-26(14-31(15-26)25(36)37)16-32(20)22(34)12-29-21(33)7-4-8-38-18-5-2-1-3-6-18/h1-3,5-6,9,13,20H,4,7-8,10-12,14-16H2,(H3,27,28)(H,29,33)(H,30,35)(H,36,37)/t20-/m0/s1 |
| InChIKey | LXVZOHSNTLRVDD-FQEVSTJZSA-N |
| XLogP | 1.20 |
| TPSA | 178.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|