C28H29N5O4S — CID 155144724
(1S,3S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-2-[2-[(4-phenoxybenzoyl)amino]acetyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 155144724) has the molecular formula C28H29N5O4S and a molecular weight of 531.64 g/mol. Its IUPAC name is (1S,3S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-2-[2-[(4-phenoxybenzoyl)amino]acetyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | (1S,3S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-2-[2-[(4-phenoxybenzoyl)amino]acetyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 155144724 |
| Molecular Formula | C28H29N5O4S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | (1S,3S,4R)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-2-[2-[(4-phenoxybenzoyl)amino]acetyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)[C@@H]2[C@@H]3CC[C@@H](C3)N2C(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C28H29N5O4S/c29-26(30)19-13-23(38-16-19)14-31-28(36)25-18-6-9-20(12-18)33(25)24(34)15-32-27(35)17-7-10-22(11-8-17)37-21-4-2-1-3-5-21/h1-5,7-8,10-11,13,16,18,20,25H,6,9,12,14-15H2,(H3,29,30)(H,31,36)(H,32,35)/t18-,20+,25+/m1/s1 |
| InChIKey | FJQKGLXKTLBCIT-AOUJKTHWSA-N |
| XLogP | 3.25 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|