C27H29N5O4S — CID 162515463
(2S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-2-methyl-1-[2-[(4-phenoxybenzoyl)amino]acetyl]pyrrolidine-2-carboxamide (PubChem CID 162515463) has the molecular formula C27H29N5O4S and a molecular weight of 519.63 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-2-methyl-1-[2-[(4-phenoxybenzoyl)amino]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-2-methyl-1-[2-[(4-phenoxybenzoyl)amino]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 162515463 |
| Molecular Formula | C27H29N5O4S |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylthiophen-2-yl)methyl]-2-methyl-1-[2-[(4-phenoxybenzoyl)amino]acetyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc(CNC(=O)[C@]2(C)CCCN2C(=O)CNC(=O)c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H29N5O4S/c1-27(26(35)31-15-22-14-19(17-37-22)24(28)29)12-5-13-32(27)23(33)16-30-25(34)18-8-10-21(11-9-18)36-20-6-3-2-4-7-20/h2-4,6-11,14,17H,5,12-13,15-16H2,1H3,(H3,28,29)(H,30,34)(H,31,35)/t27-/m0/s1 |
| InChIKey | LWOYNUMGHHWKDU-MHZLTWQESA-N |
| XLogP | 3.25 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|