C23H31NO6 — CID 58263244
3-[2-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpyrrolidin-2-yl]-2-oxoethyl]-2-oxohexanoic acid (PubChem CID 58263244) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is 3-[2-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpyrrolidin-2-yl]-2-oxoethyl]-2-oxohexanoic acid.
| Compound Name | 3-[2-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpyrrolidin-2-yl]-2-oxoethyl]-2-oxohexanoic acid |
|---|---|
| PubChem CID | 58263244 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 3-[2-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpyrrolidin-2-yl]-2-oxoethyl]-2-oxohexanoic acid |
| SMILES | CCCC(CC(=O)[C@@H]1CC(c2ccccc2)CN1C(=O)OC(C)(C)C)C(=O)C(=O)O |
| InChI | InChI=1S/C23H31NO6/c1-5-9-16(20(26)21(27)28)13-19(25)18-12-17(15-10-7-6-8-11-15)14-24(18)22(29)30-23(2,3)4/h6-8,10-11,16-18H,5,9,12-14H2,1-4H3,(H,27,28)/t16?,17?,18-/m0/s1 |
| InChIKey | YVXFMHWWGDWTQQ-ABHNRTSZSA-N |
| XLogP | 3.81 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|