C24H30F3NO7 — CID 155368948
diethyl 2-[2-[(4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2,3,6-trifluorophenyl)pyrrolidin-2-yl]-2-oxoethyl]propanedioate (PubChem CID 155368948) has the molecular formula C24H30F3NO7 and a molecular weight of 501.50 g/mol. Its IUPAC name is diethyl 2-[2-[(4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2,3,6-trifluorophenyl)pyrrolidin-2-yl]-2-oxoethyl]propanedioate.
| Compound Name | diethyl 2-[2-[(4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2,3,6-trifluorophenyl)pyrrolidin-2-yl]-2-oxoethyl]propanedioate |
|---|---|
| PubChem CID | 155368948 |
| Molecular Formula | C24H30F3NO7 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | diethyl 2-[2-[(4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2,3,6-trifluorophenyl)pyrrolidin-2-yl]-2-oxoethyl]propanedioate |
| SMILES | CCOC(=O)C(CC(=O)C1C[C@H](c2c(F)ccc(F)c2F)CN1C(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C24H30F3NO7/c1-6-33-21(30)14(22(31)34-7-2)11-18(29)17-10-13(12-28(17)23(32)35-24(3,4)5)19-15(25)8-9-16(26)20(19)27/h8-9,13-14,17H,6-7,10-12H2,1-5H3/t13-,17?/m0/s1 |
| InChIKey | NFJGCNVMPIXZLK-CWQZNGJJSA-N |
| XLogP | 3.90 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|