C17H17F4N3O3 — CID 150548708
tert-butyl (4R)-2-(2-diazoacetyl)-4-(2,3,5,6-tetrafluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 150548708) has the molecular formula C17H17F4N3O3 and a molecular weight of 387.33 g/mol. Its IUPAC name is tert-butyl (4R)-2-(2-diazoacetyl)-4-(2,3,5,6-tetrafluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4R)-2-(2-diazoacetyl)-4-(2,3,5,6-tetrafluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 150548708 |
| Molecular Formula | C17H17F4N3O3 |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | tert-butyl (4R)-2-(2-diazoacetyl)-4-(2,3,5,6-tetrafluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](c2c(F)c(F)cc(F)c2F)CC1C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C17H17F4N3O3/c1-17(2,3)27-16(26)24-7-8(4-11(24)12(25)6-23-22)13-14(20)9(18)5-10(19)15(13)21/h5-6,8,11H,4,7H2,1-3H3/t8-,11?/m0/s1 |
| InChIKey | IHKMBVDYBORZSF-YMNIQAILSA-N |
| XLogP | 3.21 |
| TPSA | 83.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|