C16H20F3NO3 — CID 146223672
tert-butyl (2R,4R)-2-methoxy-4-(2,3,6-trifluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 146223672) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-methoxy-4-(2,3,6-trifluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-methoxy-4-(2,3,6-trifluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146223672 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | tert-butyl (2R,4R)-2-methoxy-4-(2,3,6-trifluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | CO[C@@H]1C[C@H](c2c(F)ccc(F)c2F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H20F3NO3/c1-16(2,3)23-15(21)20-8-9(7-12(20)22-4)13-10(17)5-6-11(18)14(13)19/h5-6,9,12H,7-8H2,1-4H3/t9-,12+/m0/s1 |
| InChIKey | MHZXCAAITOPVET-JOYOIKCWSA-N |
| XLogP | 3.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|