C16H18F3NO4 — CID 134367848
(4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2,3,6-trifluorophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 134367848) has the molecular formula C16H18F3NO4 and a molecular weight of 345.32 g/mol. Its IUPAC name is (4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2,3,6-trifluorophenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2,3,6-trifluorophenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 134367848 |
| Molecular Formula | C16H18F3NO4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(2,3,6-trifluorophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](c2c(F)ccc(F)c2F)CC1C(=O)O |
| InChI | InChI=1S/C16H18F3NO4/c1-16(2,3)24-15(23)20-7-8(6-11(20)14(21)22)12-9(17)4-5-10(18)13(12)19/h4-5,8,11H,6-7H2,1-3H3,(H,21,22)/t8-,11?/m0/s1 |
| InChIKey | WXRLCELTMNNOJR-YMNIQAILSA-N |
| XLogP | 3.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|