C15H18F3NO2 — CID 174955976
tert-butyl (3R)-3-(2,3,6-trifluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 174955976) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is tert-butyl (3R)-3-(2,3,6-trifluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(2,3,6-trifluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 174955976 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | tert-butyl (3R)-3-(2,3,6-trifluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](c2c(F)ccc(F)c2F)C1 |
| InChI | InChI=1S/C15H18F3NO2/c1-15(2,3)21-14(20)19-7-6-9(8-19)12-10(16)4-5-11(17)13(12)18/h4-5,9H,6-8H2,1-3H3/t9-/m0/s1 |
| InChIKey | SJNSJOJGZJIADN-VIFPVBQESA-N |
| XLogP | 3.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|