C16H19F4NO3 — CID 146223634
tert-butyl (2R,4R)-2-(hydroxymethyl)-4-(2,3,5,6-tetrafluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 146223634) has the molecular formula C16H19F4NO3 and a molecular weight of 349.32 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-(hydroxymethyl)-4-(2,3,5,6-tetrafluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-(hydroxymethyl)-4-(2,3,5,6-tetrafluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146223634 |
| Molecular Formula | C16H19F4NO3 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | tert-butyl (2R,4R)-2-(hydroxymethyl)-4-(2,3,5,6-tetrafluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](c2c(F)c(F)cc(F)c2F)C[C@@H]1CO |
| InChI | InChI=1S/C16H19F4NO3/c1-16(2,3)24-15(23)21-6-8(4-9(21)7-22)12-13(19)10(17)5-11(18)14(12)20/h5,8-9,22H,4,6-7H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | NBLJVULNYKMDKE-DTWKUNHWSA-N |
| XLogP | 3.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|