C19H31NO7 — CID 155382155
diethyl 2-[2-[3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]-2-oxoethyl]propanedioate (PubChem CID 155382155) has the molecular formula C19H31NO7 and a molecular weight of 385.46 g/mol. Its IUPAC name is diethyl 2-[2-[3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]-2-oxoethyl]propanedioate.
| Compound Name | diethyl 2-[2-[3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]-2-oxoethyl]propanedioate |
|---|---|
| PubChem CID | 155382155 |
| Molecular Formula | C19H31NO7 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | diethyl 2-[2-[3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]-2-oxoethyl]propanedioate |
| SMILES | CCOC(=O)C(CC(=O)C1C(C)CCN1C(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C19H31NO7/c1-7-25-16(22)13(17(23)26-8-2)11-14(21)15-12(3)9-10-20(15)18(24)27-19(4,5)6/h12-13,15H,7-11H2,1-6H3 |
| InChIKey | JNXRPKFMWPNDER-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|