C13H22ClNO3 — CID 107072729
tert-butyl 2-(2-chloroacetyl)-3-methylpiperidine-1-carboxylate (PubChem CID 107072729) has the molecular formula C13H22ClNO3 and a molecular weight of 275.78 g/mol. Its IUPAC name is tert-butyl 2-(2-chloroacetyl)-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-chloroacetyl)-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 107072729 |
| Molecular Formula | C13H22ClNO3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | tert-butyl 2-(2-chloroacetyl)-3-methylpiperidine-1-carboxylate |
| SMILES | CC1CCCN(C(=O)OC(C)(C)C)C1C(=O)CCl |
| InChI | InChI=1S/C13H22ClNO3/c1-9-6-5-7-15(11(9)10(16)8-14)12(17)18-13(2,3)4/h9,11H,5-8H2,1-4H3 |
| InChIKey | SGGZMKJKBOXHAT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|