C11H21NO5S — CID 141429067
(2S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-sulfonic acid (PubChem CID 141429067) has the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. Its IUPAC name is (2S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-sulfonic acid.
| Compound Name | (2S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-sulfonic acid |
|---|---|
| PubChem CID | 141429067 |
| Molecular Formula | C11H21NO5S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (2S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-sulfonic acid |
| SMILES | CC1CCCN(C(=O)OC(C)(C)C)[C@H]1S(=O)(=O)O |
| InChI | InChI=1S/C11H21NO5S/c1-8-6-5-7-12(9(8)18(14,15)16)10(13)17-11(2,3)4/h8-9H,5-7H2,1-4H3,(H,14,15,16)/t8?,9-/m0/s1 |
| InChIKey | MTKNVDYUANLFJZ-GKAPJAKFSA-N |
| XLogP | 1.87 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|