C17H25NO5S — CID 141429069
(2R)-3-(4-methylphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-sulfonic acid (PubChem CID 141429069) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is (2R)-3-(4-methylphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-sulfonic acid.
| Compound Name | (2R)-3-(4-methylphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-sulfonic acid |
|---|---|
| PubChem CID | 141429069 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (2R)-3-(4-methylphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-sulfonic acid |
| SMILES | Cc1ccc(C2CCCN(C(=O)OC(C)(C)C)[C@@H]2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H25NO5S/c1-12-7-9-13(10-8-12)14-6-5-11-18(15(14)24(20,21)22)16(19)23-17(2,3)4/h7-10,14-15H,5-6,11H2,1-4H3,(H,20,21,22)/t14?,15-/m1/s1 |
| InChIKey | OUUYEMCBTJMWQS-YSSOQSIOSA-N |
| XLogP | 3.32 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|