C24H31NO3 — CID 101333766
tert-butyl (2S)-2-[hydroxy-bis(4-methylphenyl)methyl]pyrrolidine-1-carboxylate (PubChem CID 101333766) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is tert-butyl (2S)-2-[hydroxy-bis(4-methylphenyl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[hydroxy-bis(4-methylphenyl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101333766 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | tert-butyl (2S)-2-[hydroxy-bis(4-methylphenyl)methyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)[C@@H]2CCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H31NO3/c1-17-8-12-19(13-9-17)24(27,20-14-10-18(2)11-15-20)21-7-6-16-25(21)22(26)28-23(3,4)5/h8-15,21,27H,6-7,16H2,1-5H3/t21-/m0/s1 |
| InChIKey | HBSHZXZDFGJGIS-NRFANRHFSA-N |
| XLogP | 4.94 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |