C20H31NO2 — CID 11278560
tert-butyl (2R,3S)-2-hexyl-3-phenylazetidine-1-carboxylate (PubChem CID 11278560) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-hexyl-3-phenylazetidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-2-hexyl-3-phenylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 11278560 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | tert-butyl (2R,3S)-2-hexyl-3-phenylazetidine-1-carboxylate |
| SMILES | CCCCCC[C@@H]1[C@@H](c2ccccc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31NO2/c1-5-6-7-11-14-18-17(16-12-9-8-10-13-16)15-21(18)19(22)23-20(2,3)4/h8-10,12-13,17-18H,5-7,11,14-15H2,1-4H3/t17-,18-/m1/s1 |
| InChIKey | QMRWVXOGFQHERI-QZTJIDSGSA-N |
| XLogP | 5.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|