C19H29NO2 — CID 171661748
tert-butyl 3-hexyl-2,3-dihydroindole-1-carboxylate (PubChem CID 171661748) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is tert-butyl 3-hexyl-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 3-hexyl-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 171661748 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | tert-butyl 3-hexyl-2,3-dihydroindole-1-carboxylate |
| SMILES | CCCCCCC1CN(C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H29NO2/c1-5-6-7-8-11-15-14-20(18(21)22-19(2,3)4)17-13-10-9-12-16(15)17/h9-10,12-13,15H,5-8,11,14H2,1-4H3 |
| InChIKey | NZXXFAIXUCFLQP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|