C18H26N2O — CID 67614316
(3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone (PubChem CID 67614316) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone.
| Compound Name | (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 67614316 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone |
| SMILES | CCCCCC1CN(C(=O)[C@H]2CCCN2)c2ccccc21 |
| InChI | InChI=1S/C18H26N2O/c1-2-3-4-8-14-13-20(17-11-6-5-9-15(14)17)18(21)16-10-7-12-19-16/h5-6,9,11,14,16,19H,2-4,7-8,10,12-13H2,1H3/t14?,16-/m1/s1 |
| InChIKey | UBQQEUYTLRJLJS-BZSJEYESSA-N |
| XLogP | 3.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|