About (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone
(3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone (PubChem CID 67614316) has the molecular formula C18H26N2O
and a molecular weight of 286.42 g/mol. Its IUPAC name is (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone.
Molecular Properties
| Compound Name | (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone |
| PubChem CID | 67614316 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone |
| SMILES | CCCCCC1CN(C(=O)[C@H]2CCCN2)c2ccccc21 |
| InChI | InChI=1S/C18H26N2O/c1-2-3-4-8-14-13-20(17-11-6-5-9-15(14)17)18(21)16-10-7-12-19-16/h5-6,9,11,14,16,19H,2-4,7-8,10,12-13H2,1H3/t14?,16-/m1/s1 |
| InChIKey | UBQQEUYTLRJLJS-BZSJEYESSA-N |
| XLogP | 3.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone?
The IUPAC name of (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone (CID 67614316) is (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone.
What is the SMILES notation for (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone?
The canonical SMILES for (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone is CCCCCC1CN(C(=O)[C@H]2CCCN2)c2ccccc21.
What is the InChIKey of (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone?
The InChIKey is UBQQEUYTLRJLJS-BZSJEYESSA-N. The full InChI is InChI=1S/C18H26N2O/c1-2-3-4-8-14-13-20(17-11-6-5-9-15(14)17)18(21)16-10-7-12-19-16/h5-6,9,11,14,16,19H,2-4,7-8,10,12-13H2,1H3/t14?,16-/m1/s1.
What are the key properties of (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone?
(3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone has a molecular weight of 286.42 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-pentyl-2,3-dihydroindol-1-yl)-[(2R)-pyrrolidin-2-yl]methanone is sourced from PubChem (CID 67614316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).