C24H39NO4 — CID 10597437
tert-butyl 3-(2-hydroxyethyl)-4-nonoxy-2,3-dihydroindole-1-carboxylate (PubChem CID 10597437) has the molecular formula C24H39NO4 and a molecular weight of 405.58 g/mol. Its IUPAC name is tert-butyl 3-(2-hydroxyethyl)-4-nonoxy-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 3-(2-hydroxyethyl)-4-nonoxy-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 10597437 |
| Molecular Formula | C24H39NO4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | tert-butyl 3-(2-hydroxyethyl)-4-nonoxy-2,3-dihydroindole-1-carboxylate |
| SMILES | CCCCCCCCCOc1cccc2c1C(CCO)CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H39NO4/c1-5-6-7-8-9-10-11-17-28-21-14-12-13-20-22(21)19(15-16-26)18-25(20)23(27)29-24(2,3)4/h12-14,19,26H,5-11,15-18H2,1-4H3 |
| InChIKey | RGMOTSOKAKKYRH-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|