C40H50INO6 — CID 165027934
(2R)-2-[2-(4-butoxy-1-iodonaphthalen-2-yl)ethyl]oxirane;tert-butyl (1S)-5-butoxy-1-(hydroxymethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate (PubChem CID 165027934) has the molecular formula C40H50INO6 and a molecular weight of 767.74 g/mol. Its IUPAC name is (2R)-2-[2-(4-butoxy-1-iodonaphthalen-2-yl)ethyl]oxirane;tert-butyl (1S)-5-butoxy-1-(hydroxymethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate.
| Compound Name | (2R)-2-[2-(4-butoxy-1-iodonaphthalen-2-yl)ethyl]oxirane;tert-butyl (1S)-5-butoxy-1-(hydroxymethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate |
|---|---|
| PubChem CID | 165027934 |
| Molecular Formula | C40H50INO6 |
| Molecular Weight | 767.74 g/mol |
| Exact Mass | 767.27 |
| IUPAC Name | (2R)-2-[2-(4-butoxy-1-iodonaphthalen-2-yl)ethyl]oxirane;tert-butyl (1S)-5-butoxy-1-(hydroxymethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate |
| SMILES | CCCCOc1cc(CC[C@@H]2CO2)c(I)c2ccccc12.CCCCOc1cc2c(c3ccccc13)[C@H](CO)CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H29NO4.C18H21IO2/c1-5-6-11-26-19-12-18-20(17-10-8-7-9-16(17)19)15(14-24)13-23(18)21(25)27-22(2,3)4;1-2-3-10-20-17-11-13(8-9-14-12-21-14)18(19)16-7-5-4-6-15(16)17/h7-10,12,15,24H,5-6,11,13-14H2,1-4H3;4-7,11,14H,2-3,8-10,12H2,1H3/t15-;14-/m01/s1 |
| InChIKey | MELZWZJOGPBXDM-RWSINFECSA-N |
| XLogP | 9.80 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.74 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|