C27H28ClNO5 — CID 137385099
3-O-tert-butyl 7-O-methyl 1-(chloromethyl)-5-phenylmethoxy-1,2-dihydrobenzo[e]indole-3,7-dicarboxylate (PubChem CID 137385099) has the molecular formula C27H28ClNO5 and a molecular weight of 481.98 g/mol. Its IUPAC name is 3-O-tert-butyl 7-O-methyl 1-(chloromethyl)-5-phenylmethoxy-1,2-dihydrobenzo[e]indole-3,7-dicarboxylate.
| Compound Name | 3-O-tert-butyl 7-O-methyl 1-(chloromethyl)-5-phenylmethoxy-1,2-dihydrobenzo[e]indole-3,7-dicarboxylate |
|---|---|
| PubChem CID | 137385099 |
| Molecular Formula | C27H28ClNO5 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 3-O-tert-butyl 7-O-methyl 1-(chloromethyl)-5-phenylmethoxy-1,2-dihydrobenzo[e]indole-3,7-dicarboxylate |
| SMILES | COC(=O)c1ccc2c3c(cc(OCc4ccccc4)c2c1)N(C(=O)OC(C)(C)C)CC3CCl |
| InChI | InChI=1S/C27H28ClNO5/c1-27(2,3)34-26(31)29-15-19(14-28)24-20-11-10-18(25(30)32-4)12-21(20)23(13-22(24)29)33-16-17-8-6-5-7-9-17/h5-13,19H,14-16H2,1-4H3 |
| InChIKey | ZUZMAOYGWRMNAP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|