C30H35ClN2O7 — CID 10918841
3-O,6-O-ditert-butyl 2-O-methyl 8-(chloromethyl)-4-phenylmethoxy-7,8-dihydropyrrolo[3,2-e]indole-2,3,6-tricarboxylate (PubChem CID 10918841) has the molecular formula C30H35ClN2O7 and a molecular weight of 571.07 g/mol. Its IUPAC name is 3-O,6-O-ditert-butyl 2-O-methyl 8-(chloromethyl)-4-phenylmethoxy-7,8-dihydropyrrolo[3,2-e]indole-2,3,6-tricarboxylate.
| Compound Name | 3-O,6-O-ditert-butyl 2-O-methyl 8-(chloromethyl)-4-phenylmethoxy-7,8-dihydropyrrolo[3,2-e]indole-2,3,6-tricarboxylate |
|---|---|
| PubChem CID | 10918841 |
| Molecular Formula | C30H35ClN2O7 |
| Molecular Weight | 571.07 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 3-O,6-O-ditert-butyl 2-O-methyl 8-(chloromethyl)-4-phenylmethoxy-7,8-dihydropyrrolo[3,2-e]indole-2,3,6-tricarboxylate |
| SMILES | COC(=O)c1cc2c3c(cc(OCc4ccccc4)c2n1C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)CC3CCl |
| InChI | InChI=1S/C30H35ClN2O7/c1-29(2,3)39-27(35)32-16-19(15-31)24-20-13-22(26(34)37-7)33(28(36)40-30(4,5)6)25(20)23(14-21(24)32)38-17-18-11-9-8-10-12-18/h8-14,19H,15-17H2,1-7H3 |
| InChIKey | OGQAYVUPTQRFRK-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 96.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.07 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|