C31H38ClN5O5 — CID 118129571
tert-butyl 5-[[4-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]phenyl]methoxy]-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate (PubChem CID 118129571) has the molecular formula C31H38ClN5O5 and a molecular weight of 596.13 g/mol. Its IUPAC name is tert-butyl 5-[[4-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]phenyl]methoxy]-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate.
| Compound Name | tert-butyl 5-[[4-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]phenyl]methoxy]-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate |
|---|---|
| PubChem CID | 118129571 |
| Molecular Formula | C31H38ClN5O5 |
| Molecular Weight | 596.13 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | tert-butyl 5-[[4-[[(2S)-2-amino-5-(carbamoylamino)pentanoyl]amino]phenyl]methoxy]-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CCl)c2c1cc(OCc1ccc(NC(=O)[C@@H](N)CCCNC(N)=O)cc1)c1ccccc21 |
| InChI | InChI=1S/C31H38ClN5O5/c1-31(2,3)42-30(40)37-17-20(16-32)27-23-8-5-4-7-22(23)26(15-25(27)37)41-18-19-10-12-21(13-11-19)36-28(38)24(33)9-6-14-35-29(34)39/h4-5,7-8,10-13,15,20,24H,6,9,14,16-18,33H2,1-3H3,(H,36,38)(H3,34,35,39)/t20?,24-/m0/s1 |
| InChIKey | IBUBEKMWSSANBB-JWIMYKKASA-N |
| XLogP | 5.21 |
| TPSA | 149.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.13 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|