C20H22ClNO4 — CID 15485854
tert-butyl (1S)-5-acetyloxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate (PubChem CID 15485854) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is tert-butyl (1S)-5-acetyloxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate.
| Compound Name | tert-butyl (1S)-5-acetyloxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate |
|---|---|
| PubChem CID | 15485854 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | tert-butyl (1S)-5-acetyloxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carboxylate |
| SMILES | CC(=O)Oc1cc2c(c3ccccc13)[C@H](CCl)CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H22ClNO4/c1-12(23)25-17-9-16-18(15-8-6-5-7-14(15)17)13(10-21)11-22(16)19(24)26-20(2,3)4/h5-9,13H,10-11H2,1-4H3/t13-/m1/s1 |
| InChIKey | ZRKDETNIGZDSOH-CYBMUJFWSA-N |
| XLogP | 4.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|