C41H35ClN2O6 — CID 138457861
[3-[4-[5-acetyloxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carbonyl]cubane-1-carbonyl]-1-ethyl-1,2-dihydrobenzo[e]indol-5-yl] acetate (PubChem CID 138457861) has the molecular formula C41H35ClN2O6 and a molecular weight of 687.19 g/mol. Its IUPAC name is [3-[4-[5-acetyloxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carbonyl]cubane-1-carbonyl]-1-ethyl-1,2-dihydrobenzo[e]indol-5-yl] acetate.
| Compound Name | [3-[4-[5-acetyloxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carbonyl]cubane-1-carbonyl]-1-ethyl-1,2-dihydrobenzo[e]indol-5-yl] acetate |
|---|---|
| PubChem CID | 138457861 |
| Molecular Formula | C41H35ClN2O6 |
| Molecular Weight | 687.19 g/mol |
| Exact Mass | 686.22 |
| IUPAC Name | [3-[4-[5-acetyloxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carbonyl]cubane-1-carbonyl]-1-ethyl-1,2-dihydrobenzo[e]indol-5-yl] acetate |
| SMILES | CCC1CN(C(=O)C23C4C5C2C2C3C4C52C(=O)N2CC(CCl)c3c2cc(OC(C)=O)c2ccccc32)c2cc(OC(C)=O)c3ccccc3c21 |
| InChI | InChI=1S/C41H35ClN2O6/c1-4-20-16-43(26-13-28(49-18(2)45)22-9-5-7-11-24(22)30(20)26)38(47)40-32-35-33(40)37-34(40)36(32)41(35,37)39(48)44-17-21(15-42)31-25-12-8-6-10-23(25)29(14-27(31)44)50-19(3)46/h5-14,20-21,32-37H,4,15-17H2,1-3H3 |
| InChIKey | DBWJDUHACHXNPN-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.19 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|