C40H28ClN3O9S — CID 144891934
[3-[5-[1-(chloromethyl)-5-(4-nitrophenoxy)carbonyloxy-1,2-dihydrobenzo[e]indole-3-carbonyl]thiophene-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] acetate (PubChem CID 144891934) has the molecular formula C40H28ClN3O9S and a molecular weight of 762.20 g/mol. Its IUPAC name is [3-[5-[1-(chloromethyl)-5-(4-nitrophenoxy)carbonyloxy-1,2-dihydrobenzo[e]indole-3-carbonyl]thiophene-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] acetate.
| Compound Name | [3-[5-[1-(chloromethyl)-5-(4-nitrophenoxy)carbonyloxy-1,2-dihydrobenzo[e]indole-3-carbonyl]thiophene-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] acetate |
|---|---|
| PubChem CID | 144891934 |
| Molecular Formula | C40H28ClN3O9S |
| Molecular Weight | 762.20 g/mol |
| Exact Mass | 761.12 |
| IUPAC Name | [3-[5-[1-(chloromethyl)-5-(4-nitrophenoxy)carbonyloxy-1,2-dihydrobenzo[e]indole-3-carbonyl]thiophene-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c3ccccc13)CCN2C(=O)c1ccc(C(=O)N2CC(CCl)c3c2cc(OC(=O)Oc2ccc([N+](=O)[O-])cc2)c2ccccc32)s1 |
| InChI | InChI=1S/C40H28ClN3O9S/c1-22(45)51-33-18-31-27(26-6-2-3-7-28(26)33)16-17-42(31)38(46)35-14-15-36(54-35)39(47)43-21-23(20-41)37-30-9-5-4-8-29(30)34(19-32(37)43)53-40(48)52-25-12-10-24(11-13-25)44(49)50/h2-15,18-19,23H,16-17,20-21H2,1H3 |
| InChIKey | QOZPICGDZZAUBH-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 145.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.20 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|