C51H37Cl2N3O8 — CID 118265216
9H-fluoren-9-ylmethyl 2,5-bis[(1S)-5-acetyloxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carbonyl]pyrrole-1-carboxylate (PubChem CID 118265216) has the molecular formula C51H37Cl2N3O8 and a molecular weight of 890.78 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2,5-bis[(1S)-5-acetyloxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carbonyl]pyrrole-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 2,5-bis[(1S)-5-acetyloxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carbonyl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 118265216 |
| Molecular Formula | C51H37Cl2N3O8 |
| Molecular Weight | 890.78 g/mol |
| Exact Mass | 889.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2,5-bis[(1S)-5-acetyloxy-1-(chloromethyl)-1,2-dihydrobenzo[e]indole-3-carbonyl]pyrrole-1-carboxylate |
| SMILES | CC(=O)Oc1cc2c(c3ccccc13)[C@H](CCl)CN2C(=O)C1=C=C=C(C(=O)N2C[C@@H](CCl)c3c2cc(OC(C)=O)c2ccccc32)N1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C51H37Cl2N3O8/c1-28(57)63-45-21-43-47(38-17-9-7-15-36(38)45)30(23-52)25-54(43)49(59)41-19-20-42(56(41)51(61)62-27-40-34-13-5-3-11-32(34)33-12-4-6-14-35(33)40)50(60)55-26-31(24-53)48-39-18-10-8-16-37(39)46(22-44(48)55)64-29(2)58/h3-18,21-22,30-31,40H,23-27H2,1-2H3/t30-,31-/m1/s1 |
| InChIKey | SVRODYXNPFLGNV-FIRIVFDPSA-N |
| XLogP | 9.67 |
| TPSA | 122.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.78 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|