C34H26ClN3O4 — CID 158467285
[1-(chloromethyl)-3-[5-[2-(1H-indol-2-yl)-2-oxoethyl]-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] acetate (PubChem CID 158467285) has the molecular formula C34H26ClN3O4 and a molecular weight of 576.05 g/mol. Its IUPAC name is [1-(chloromethyl)-3-[5-[2-(1H-indol-2-yl)-2-oxoethyl]-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] acetate.
| Compound Name | [1-(chloromethyl)-3-[5-[2-(1H-indol-2-yl)-2-oxoethyl]-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] acetate |
|---|---|
| PubChem CID | 158467285 |
| Molecular Formula | C34H26ClN3O4 |
| Molecular Weight | 576.05 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | [1-(chloromethyl)-3-[5-[2-(1H-indol-2-yl)-2-oxoethyl]-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c3ccccc13)C(CCl)CN2C(=O)c1cc2cc(CC(=O)c3cc4ccccc4[nH]3)ccc2[nH]1 |
| InChI | InChI=1S/C34H26ClN3O4/c1-19(39)42-32-16-30-33(25-8-4-3-7-24(25)32)23(17-35)18-38(30)34(41)29-15-22-12-20(10-11-27(22)37-29)13-31(40)28-14-21-6-2-5-9-26(21)36-28/h2-12,14-16,23,36-37H,13,17-18H2,1H3 |
| InChIKey | WNEAWVXZQJYSBJ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.05 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|