C35H30ClN5O4 — CID 118641873
[1-(chloromethyl)-3-[5-(1H-indole-2-carbonylamino)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] N-propylcarbamate (PubChem CID 118641873) has the molecular formula C35H30ClN5O4 and a molecular weight of 620.11 g/mol. Its IUPAC name is [1-(chloromethyl)-3-[5-(1H-indole-2-carbonylamino)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] N-propylcarbamate.
| Compound Name | [1-(chloromethyl)-3-[5-(1H-indole-2-carbonylamino)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] N-propylcarbamate |
|---|---|
| PubChem CID | 118641873 |
| Molecular Formula | C35H30ClN5O4 |
| Molecular Weight | 620.11 g/mol |
| Exact Mass | 619.20 |
| IUPAC Name | [1-(chloromethyl)-3-[5-(1H-indole-2-carbonylamino)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] N-propylcarbamate |
| SMILES | CCCNC(=O)Oc1cc2c(c3ccccc13)C(CCl)CN2C(=O)c1cc2cc(NC(=O)c3cc4ccccc4[nH]3)ccc2[nH]1 |
| InChI | InChI=1S/C35H30ClN5O4/c1-2-13-37-35(44)45-31-17-30-32(25-9-5-4-8-24(25)31)22(18-36)19-41(30)34(43)29-16-21-14-23(11-12-27(21)40-29)38-33(42)28-15-20-7-3-6-10-26(20)39-28/h3-12,14-17,22,39-40H,2,13,18-19H2,1H3,(H,37,44)(H,38,42) |
| InChIKey | BANLJWKCDDIQNS-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 119.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.11 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|