C33H26ClN3O3 — CID 58260014
2-[2-[(1S)-1-(chloromethyl)-5-methoxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-1-(1H-indol-2-yl)ethanone (PubChem CID 58260014) has the molecular formula C33H26ClN3O3 and a molecular weight of 548.04 g/mol. Its IUPAC name is 2-[2-[(1S)-1-(chloromethyl)-5-methoxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-1-(1H-indol-2-yl)ethanone.
| Compound Name | 2-[2-[(1S)-1-(chloromethyl)-5-methoxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-1-(1H-indol-2-yl)ethanone |
|---|---|
| PubChem CID | 58260014 |
| Molecular Formula | C33H26ClN3O3 |
| Molecular Weight | 548.04 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 2-[2-[(1S)-1-(chloromethyl)-5-methoxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-1-(1H-indol-2-yl)ethanone |
| SMILES | COc1cc2c(c3ccccc13)[C@H](CCl)CN2C(=O)c1cc2cc(CC(=O)c3cc4ccccc4[nH]3)ccc2[nH]1 |
| InChI | InChI=1S/C33H26ClN3O3/c1-40-31-16-29-32(24-8-4-3-7-23(24)31)22(17-34)18-37(29)33(39)28-15-21-12-19(10-11-26(21)36-28)13-30(38)27-14-20-6-2-5-9-25(20)35-27/h2-12,14-16,22,35-36H,13,17-18H2,1H3/t22-/m1/s1 |
| InChIKey | HHLWQJCPHNEXJA-JOCHJYFZSA-N |
| XLogP | 7.22 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.04 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|