C25H22ClN2O6P — CID 158700625
[(1S)-1-(chloromethyl)-3-[5-(2-oxopropyl)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] dihydrogen phosphate (PubChem CID 158700625) has the molecular formula C25H22ClN2O6P and a molecular weight of 512.89 g/mol. Its IUPAC name is [(1S)-1-(chloromethyl)-3-[5-(2-oxopropyl)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] dihydrogen phosphate.
| Compound Name | [(1S)-1-(chloromethyl)-3-[5-(2-oxopropyl)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 158700625 |
| Molecular Formula | C25H22ClN2O6P |
| Molecular Weight | 512.89 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | [(1S)-1-(chloromethyl)-3-[5-(2-oxopropyl)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] dihydrogen phosphate |
| SMILES | CC(=O)Cc1ccc2[nH]c(C(=O)N3C[C@@H](CCl)c4c3cc(OP(=O)(O)O)c3ccccc43)cc2c1 |
| InChI | InChI=1S/C25H22ClN2O6P/c1-14(29)8-15-6-7-20-16(9-15)10-21(27-20)25(30)28-13-17(12-26)24-19-5-3-2-4-18(19)23(11-22(24)28)34-35(31,32)33/h2-7,9-11,17,27H,8,12-13H2,1H3,(H2,31,32,33)/t17-/m1/s1 |
| InChIKey | LEEHLZGLJYIGET-QGZVFWFLSA-N |
| XLogP | 4.91 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|