C36H32ClN5O5 — CID 24755111
tert-butyl N-[[(1S)-1-(chloromethyl)-3-[5-(1H-indole-2-carbonylamino)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl]oxy]carbamate (PubChem CID 24755111) has the molecular formula C36H32ClN5O5 and a molecular weight of 650.14 g/mol. Its IUPAC name is tert-butyl N-[[(1S)-1-(chloromethyl)-3-[5-(1H-indole-2-carbonylamino)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl]oxy]carbamate.
| Compound Name | tert-butyl N-[[(1S)-1-(chloromethyl)-3-[5-(1H-indole-2-carbonylamino)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl]oxy]carbamate |
|---|---|
| PubChem CID | 24755111 |
| Molecular Formula | C36H32ClN5O5 |
| Molecular Weight | 650.14 g/mol |
| Exact Mass | 649.21 |
| IUPAC Name | tert-butyl N-[[(1S)-1-(chloromethyl)-3-[5-(1H-indole-2-carbonylamino)-1H-indole-2-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl]oxy]carbamate |
| SMILES | CC(C)(C)OC(=O)NOc1cc2c(c3ccccc13)[C@H](CCl)CN2C(=O)c1cc2cc(NC(=O)c3cc4ccccc4[nH]3)ccc2[nH]1 |
| InChI | InChI=1S/C36H32ClN5O5/c1-36(2,3)46-35(45)41-47-31-17-30-32(25-10-6-5-9-24(25)31)22(18-37)19-42(30)34(44)29-16-21-14-23(12-13-27(21)40-29)38-33(43)28-15-20-8-4-7-11-26(20)39-28/h4-17,22,39-40H,18-19H2,1-3H3,(H,38,43)(H,41,45)/t22-/m1/s1 |
| InChIKey | XTLVCBPHMQCFAN-JOCHJYFZSA-N |
| XLogP | 7.86 |
| TPSA | 128.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.14 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|